C10H13NO5 — CID 103890596
2,6-dihydroxy-N-(2-methoxyethoxy)benzamide (PubChem CID 103890596) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2,6-dihydroxy-N-(2-methoxyethoxy)benzamide.
| Compound Name | 2,6-dihydroxy-N-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 103890596 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2,6-dihydroxy-N-(2-methoxyethoxy)benzamide |
| SMILES | COCCONC(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C10H13NO5/c1-15-5-6-16-11-10(14)9-7(12)3-2-4-8(9)13/h2-4,12-13H,5-6H2,1H3,(H,11,14) |
| InChIKey | AVHJGZAVKSQZSU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|