C14H18O8 — CID 15500945
bis(2-methoxyethyl) 3,6-dihydroxybenzene-1,2-dicarboxylate (PubChem CID 15500945) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is bis(2-methoxyethyl) 3,6-dihydroxybenzene-1,2-dicarboxylate.
| Compound Name | bis(2-methoxyethyl) 3,6-dihydroxybenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 15500945 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | bis(2-methoxyethyl) 3,6-dihydroxybenzene-1,2-dicarboxylate |
| SMILES | COCCOC(=O)c1c(O)ccc(O)c1C(=O)OCCOC |
| InChI | InChI=1S/C14H18O8/c1-19-5-7-21-13(17)11-9(15)3-4-10(16)12(11)14(18)22-8-6-20-2/h3-4,15-16H,5-8H2,1-2H3 |
| InChIKey | XPTZKSVIHBLSSX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|