C16H23ClO4 — CID 11771428
2-methoxyethyl 3-(2-chloroethyl)-2,4-diethyl-6-hydroxybenzoate (PubChem CID 11771428) has the molecular formula C16H23ClO4 and a molecular weight of 314.81 g/mol. Its IUPAC name is 2-methoxyethyl 3-(2-chloroethyl)-2,4-diethyl-6-hydroxybenzoate.
| Compound Name | 2-methoxyethyl 3-(2-chloroethyl)-2,4-diethyl-6-hydroxybenzoate |
|---|---|
| PubChem CID | 11771428 |
| Molecular Formula | C16H23ClO4 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-methoxyethyl 3-(2-chloroethyl)-2,4-diethyl-6-hydroxybenzoate |
| SMILES | CCc1cc(O)c(C(=O)OCCOC)c(CC)c1CCCl |
| InChI | InChI=1S/C16H23ClO4/c1-4-11-10-14(18)15(16(19)21-9-8-20-3)12(5-2)13(11)6-7-17/h10,18H,4-9H2,1-3H3 |
| InChIKey | NZXLOVSOLYMQLF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|