C12H15FO2 — CID 102273469
1-(2,4-diethyl-3-fluoro-6-hydroxyphenyl)ethanone (PubChem CID 102273469) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is 1-(2,4-diethyl-3-fluoro-6-hydroxyphenyl)ethanone.
| Compound Name | 1-(2,4-diethyl-3-fluoro-6-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 102273469 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-(2,4-diethyl-3-fluoro-6-hydroxyphenyl)ethanone |
| SMILES | CCc1cc(O)c(C(C)=O)c(CC)c1F |
| InChI | InChI=1S/C12H15FO2/c1-4-8-6-10(15)11(7(3)14)9(5-2)12(8)13/h6,15H,4-5H2,1-3H3 |
| InChIKey | BMGPQVLKTOYKHT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |