3,4-diethyl-2,6-dihydroxybenzoic acid

C11H14O4 — CID 141390426

IUPAC3,4-diethyl-2,6-dihydroxybenzoic acid
SMILESCCc1cc(O)c(C(=O)O)c(O)c1CC
InChIInChI=1S/C11H14O4/c1-3-6-5-8(12)9(11(14)15)10(13)7(6)4-2/h5,12-13H,3-4H2,1-2H3,(H,14,15)
InChIKeyNAVJUNGYMHJOAB-UHFFFAOYSA-N
MW210.23 g/mol
LogP1.92
Rot. Bonds3

About 3,4-diethyl-2,6-dihydroxybenzoic acid

3,4-diethyl-2,6-dihydroxybenzoic acid (PubChem CID 141390426) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3,4-diethyl-2,6-dihydroxybenzoic acid.

Molecular Properties

Compound Name3,4-diethyl-2,6-dihydroxybenzoic acid
PubChem CID141390426
Molecular FormulaC11H14O4
Molecular Weight210.23 g/mol
Exact Mass210.09
IUPAC Name3,4-diethyl-2,6-dihydroxybenzoic acid
SMILESCCc1cc(O)c(C(=O)O)c(O)c1CC
InChIInChI=1S/C11H14O4/c1-3-6-5-8(12)9(11(14)15)10(13)7(6)4-2/h5,12-13H,3-4H2,1-2H3,(H,14,15)
InChIKeyNAVJUNGYMHJOAB-UHFFFAOYSA-N
XLogP1.92
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 51.92
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3,4-diethyl-2,6-dihydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-diethyl-2,6-dihydroxybenzoic acid?
The IUPAC name of 3,4-diethyl-2,6-dihydroxybenzoic acid (CID 141390426) is 3,4-diethyl-2,6-dihydroxybenzoic acid.
What is the SMILES notation for 3,4-diethyl-2,6-dihydroxybenzoic acid?
The canonical SMILES for 3,4-diethyl-2,6-dihydroxybenzoic acid is CCc1cc(O)c(C(=O)O)c(O)c1CC.
What is the InChIKey of 3,4-diethyl-2,6-dihydroxybenzoic acid?
The InChIKey is NAVJUNGYMHJOAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4/c1-3-6-5-8(12)9(11(14)15)10(13)7(6)4-2/h5,12-13H,3-4H2,1-2H3,(H,14,15).
What are the key properties of 3,4-diethyl-2,6-dihydroxybenzoic acid?
3,4-diethyl-2,6-dihydroxybenzoic acid has a molecular weight of 210.23 g/mol, XLogP of 1.92, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethyl-2,6-dihydroxybenzoic acid is sourced from PubChem (CID 141390426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).