C12H18O3 — CID 154435107
3-ethoxy-4,5-diethylbenzene-1,2-diol (PubChem CID 154435107) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 3-ethoxy-4,5-diethylbenzene-1,2-diol.
| Compound Name | 3-ethoxy-4,5-diethylbenzene-1,2-diol |
|---|---|
| PubChem CID | 154435107 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 3-ethoxy-4,5-diethylbenzene-1,2-diol |
| SMILES | CCOc1c(O)c(O)cc(CC)c1CC |
| InChI | InChI=1S/C12H18O3/c1-4-8-7-10(13)11(14)12(15-6-3)9(8)5-2/h7,13-14H,4-6H2,1-3H3 |
| InChIKey | ACFWCIWYJBUESY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|