C21H36O3 — CID 154435214
3-nonoxy-4,5-dipropylbenzene-1,2-diol (PubChem CID 154435214) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is 3-nonoxy-4,5-dipropylbenzene-1,2-diol.
| Compound Name | 3-nonoxy-4,5-dipropylbenzene-1,2-diol |
|---|---|
| PubChem CID | 154435214 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | 3-nonoxy-4,5-dipropylbenzene-1,2-diol |
| SMILES | CCCCCCCCCOc1c(O)c(O)cc(CCC)c1CCC |
| InChI | InChI=1S/C21H36O3/c1-4-7-8-9-10-11-12-15-24-21-18(14-6-3)17(13-5-2)16-19(22)20(21)23/h16,22-23H,4-15H2,1-3H3 |
| InChIKey | UPHZAUBKTYTUNV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|