C19H32O3 — CID 154435210
3-heptoxy-4,5-dipropylbenzene-1,2-diol (PubChem CID 154435210) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 3-heptoxy-4,5-dipropylbenzene-1,2-diol.
| Compound Name | 3-heptoxy-4,5-dipropylbenzene-1,2-diol |
|---|---|
| PubChem CID | 154435210 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 3-heptoxy-4,5-dipropylbenzene-1,2-diol |
| SMILES | CCCCCCCOc1c(O)c(O)cc(CCC)c1CCC |
| InChI | InChI=1S/C19H32O3/c1-4-7-8-9-10-13-22-19-16(12-6-3)15(11-5-2)14-17(20)18(19)21/h14,20-21H,4-13H2,1-3H3 |
| InChIKey | GSVVLVOOWRKYPV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|