C18H30O3 — CID 154435208
3-hexoxy-4,5-dipropylbenzene-1,2-diol (PubChem CID 154435208) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-hexoxy-4,5-dipropylbenzene-1,2-diol.
| Compound Name | 3-hexoxy-4,5-dipropylbenzene-1,2-diol |
|---|---|
| PubChem CID | 154435208 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 3-hexoxy-4,5-dipropylbenzene-1,2-diol |
| SMILES | CCCCCCOc1c(O)c(O)cc(CCC)c1CCC |
| InChI | InChI=1S/C18H30O3/c1-4-7-8-9-12-21-18-15(11-6-3)14(10-5-2)13-16(19)17(18)20/h13,19-20H,4-12H2,1-3H3 |
| InChIKey | CCAKOXKMMRCHLB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|