C15H24O3 — CID 154435439
4-hexyl-3-propoxybenzene-1,2-diol (PubChem CID 154435439) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 4-hexyl-3-propoxybenzene-1,2-diol.
| Compound Name | 4-hexyl-3-propoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 154435439 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 4-hexyl-3-propoxybenzene-1,2-diol |
| SMILES | CCCCCCc1ccc(O)c(O)c1OCCC |
| InChI | InChI=1S/C15H24O3/c1-3-5-6-7-8-12-9-10-13(16)14(17)15(12)18-11-4-2/h9-10,16-17H,3-8,11H2,1-2H3 |
| InChIKey | VJOAPQSXTNVXLK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|