C12H18O2 — CID 162375138
4-ethoxy-5-ethyl-2,3-dimethylphenol (PubChem CID 162375138) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 4-ethoxy-5-ethyl-2,3-dimethylphenol.
| Compound Name | 4-ethoxy-5-ethyl-2,3-dimethylphenol |
|---|---|
| PubChem CID | 162375138 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4-ethoxy-5-ethyl-2,3-dimethylphenol |
| SMILES | CCOc1c(CC)cc(O)c(C)c1C |
| InChI | InChI=1S/C12H18O2/c1-5-10-7-11(13)8(3)9(4)12(10)14-6-2/h7,13H,5-6H2,1-4H3 |
| InChIKey | FZSLVHFOSSBGSV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |