C12H18O2 — CID 139946402
5-ethyl-2-methyl-3-propylbenzene-1,4-diol (PubChem CID 139946402) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 5-ethyl-2-methyl-3-propylbenzene-1,4-diol.
| Compound Name | 5-ethyl-2-methyl-3-propylbenzene-1,4-diol |
|---|---|
| PubChem CID | 139946402 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 5-ethyl-2-methyl-3-propylbenzene-1,4-diol |
| SMILES | CCCc1c(C)c(O)cc(CC)c1O |
| InChI | InChI=1S/C12H18O2/c1-4-6-10-8(3)11(13)7-9(5-2)12(10)14/h7,13-14H,4-6H2,1-3H3 |
| InChIKey | WSIRUBIDRAGXSH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|