C15H24O — CID 139832159
2-ethyl-3-methyl-4,5-dipropylphenol (PubChem CID 139832159) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-ethyl-3-methyl-4,5-dipropylphenol.
| Compound Name | 2-ethyl-3-methyl-4,5-dipropylphenol |
|---|---|
| PubChem CID | 139832159 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2-ethyl-3-methyl-4,5-dipropylphenol |
| SMILES | CCCc1cc(O)c(CC)c(C)c1CCC |
| InChI | InChI=1S/C15H24O/c1-5-8-12-10-15(16)13(7-3)11(4)14(12)9-6-2/h10,16H,5-9H2,1-4H3 |
| InChIKey | KHEIPQGHWRITQT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |