About 2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol
2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol (PubChem CID 159775903) has the molecular formula C17H22O4
and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol.
Molecular Properties
| Compound Name | 2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol |
| PubChem CID | 159775903 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol |
| SMILES | CCCc1c(O)cccc1O.CCc1c(O)cccc1O |
| InChI | InChI=1S/C9H12O2.C8H10O2/c1-2-4-7-8(10)5-3-6-9(7)11;1-2-6-7(9)4-3-5-8(6)10/h3,5-6,10-11H,2,4H2,1H3;3-5,9-10H,2H2,1H3 |
| InChIKey | NGSSOPQAXNJNJB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol?
The IUPAC name of 2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol (CID 159775903) is 2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol.
What is the SMILES notation for 2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol?
The canonical SMILES for 2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol is CCCc1c(O)cccc1O.CCc1c(O)cccc1O.
What is the InChIKey of 2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol?
The InChIKey is NGSSOPQAXNJNJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.C8H10O2/c1-2-4-7-8(10)5-3-6-9(7)11;1-2-6-7(9)4-3-5-8(6)10/h3,5-6,10-11H,2,4H2,1H3;3-5,9-10H,2H2,1H3.
What are the key properties of 2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol?
2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol has a molecular weight of 290.36 g/mol, XLogP of 3.71, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbenzene-1,3-diol;2-propylbenzene-1,3-diol is sourced from PubChem (CID 159775903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).