About 3-chloro-2-propylphenol
3-chloro-2-propylphenol (PubChem CID 15747295) has the molecular formula C9H11ClO
and a molecular weight of 170.64 g/mol. Its IUPAC name is 3-chloro-2-propylphenol.
Molecular Properties
| Compound Name | 3-chloro-2-propylphenol |
| PubChem CID | 15747295 |
| Molecular Formula | C9H11ClO |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 3-chloro-2-propylphenol |
| SMILES | CCCc1c(O)cccc1Cl |
| InChI | InChI=1S/C9H11ClO/c1-2-4-7-8(10)5-3-6-9(7)11/h3,5-6,11H,2,4H2,1H3 |
| InChIKey | BBRQWWFIBYHQTA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-2-propylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-propylphenol?
The IUPAC name of 3-chloro-2-propylphenol (CID 15747295) is 3-chloro-2-propylphenol.
What is the SMILES notation for 3-chloro-2-propylphenol?
The canonical SMILES for 3-chloro-2-propylphenol is CCCc1c(O)cccc1Cl.
What is the InChIKey of 3-chloro-2-propylphenol?
The InChIKey is BBRQWWFIBYHQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO/c1-2-4-7-8(10)5-3-6-9(7)11/h3,5-6,11H,2,4H2,1H3.
What are the key properties of 3-chloro-2-propylphenol?
3-chloro-2-propylphenol has a molecular weight of 170.64 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-propylphenol is sourced from PubChem (CID 15747295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).