About 3-chloro-2-heptylphenol
3-chloro-2-heptylphenol (PubChem CID 71090054) has the molecular formula C13H19ClO
and a molecular weight of 226.75 g/mol. Its IUPAC name is 3-chloro-2-heptylphenol.
Molecular Properties
| Compound Name | 3-chloro-2-heptylphenol |
| PubChem CID | 71090054 |
| Molecular Formula | C13H19ClO |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-chloro-2-heptylphenol |
| SMILES | CCCCCCCc1c(O)cccc1Cl |
| InChI | InChI=1S/C13H19ClO/c1-2-3-4-5-6-8-11-12(14)9-7-10-13(11)15/h7,9-10,15H,2-6,8H2,1H3 |
| InChIKey | WDOYQZYTRZBBJB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-heptylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-heptylphenol?
The IUPAC name of 3-chloro-2-heptylphenol (CID 71090054) is 3-chloro-2-heptylphenol.
What is the SMILES notation for 3-chloro-2-heptylphenol?
The canonical SMILES for 3-chloro-2-heptylphenol is CCCCCCCc1c(O)cccc1Cl.
What is the InChIKey of 3-chloro-2-heptylphenol?
The InChIKey is WDOYQZYTRZBBJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClO/c1-2-3-4-5-6-8-11-12(14)9-7-10-13(11)15/h7,9-10,15H,2-6,8H2,1H3.
What are the key properties of 3-chloro-2-heptylphenol?
3-chloro-2-heptylphenol has a molecular weight of 226.75 g/mol, XLogP of 4.56, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-heptylphenol is sourced from PubChem (CID 71090054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).