About 3-ethyl-2-octylphenol
3-ethyl-2-octylphenol (PubChem CID 66867297) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is 3-ethyl-2-octylphenol.
Molecular Properties
| Compound Name | 3-ethyl-2-octylphenol |
| PubChem CID | 66867297 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 3-ethyl-2-octylphenol |
| SMILES | CCCCCCCCc1c(O)cccc1CC |
| InChI | InChI=1S/C16H26O/c1-3-5-6-7-8-9-12-15-14(4-2)11-10-13-16(15)17/h10-11,13,17H,3-9,12H2,1-2H3 |
| InChIKey | VHJIUJROBSJFCM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-octylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-octylphenol?
The IUPAC name of 3-ethyl-2-octylphenol (CID 66867297) is 3-ethyl-2-octylphenol.
What is the SMILES notation for 3-ethyl-2-octylphenol?
The canonical SMILES for 3-ethyl-2-octylphenol is CCCCCCCCc1c(O)cccc1CC.
What is the InChIKey of 3-ethyl-2-octylphenol?
The InChIKey is VHJIUJROBSJFCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O/c1-3-5-6-7-8-9-12-15-14(4-2)11-10-13-16(15)17/h10-11,13,17H,3-9,12H2,1-2H3.
What are the key properties of 3-ethyl-2-octylphenol?
3-ethyl-2-octylphenol has a molecular weight of 234.38 g/mol, XLogP of 4.86, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-octylphenol is sourced from PubChem (CID 66867297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).