About 3-butyl-2-hexylphenol
3-butyl-2-hexylphenol (PubChem CID 66867063) has the molecular formula C16H26O
and a molecular weight of 234.38 g/mol. Its IUPAC name is 3-butyl-2-hexylphenol.
Molecular Properties
| Compound Name | 3-butyl-2-hexylphenol |
| PubChem CID | 66867063 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 3-butyl-2-hexylphenol |
| SMILES | CCCCCCc1c(O)cccc1CCCC |
| InChI | InChI=1S/C16H26O/c1-3-5-7-8-12-15-14(10-6-4-2)11-9-13-16(15)17/h9,11,13,17H,3-8,10,12H2,1-2H3 |
| InChIKey | MWMXGRQJWZPMBI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-2-hexylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-2-hexylphenol?
The IUPAC name of 3-butyl-2-hexylphenol (CID 66867063) is 3-butyl-2-hexylphenol.
What is the SMILES notation for 3-butyl-2-hexylphenol?
The canonical SMILES for 3-butyl-2-hexylphenol is CCCCCCc1c(O)cccc1CCCC.
What is the InChIKey of 3-butyl-2-hexylphenol?
The InChIKey is MWMXGRQJWZPMBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O/c1-3-5-7-8-12-15-14(10-6-4-2)11-9-13-16(15)17/h9,11,13,17H,3-8,10,12H2,1-2H3.
What are the key properties of 3-butyl-2-hexylphenol?
3-butyl-2-hexylphenol has a molecular weight of 234.38 g/mol, XLogP of 4.86, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2-hexylphenol is sourced from PubChem (CID 66867063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).