About 3-amino-2-decylphenol
3-amino-2-decylphenol (PubChem CID 70595254) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is 3-amino-2-decylphenol.
Molecular Properties
| Compound Name | 3-amino-2-decylphenol |
| PubChem CID | 70595254 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 3-amino-2-decylphenol |
| SMILES | CCCCCCCCCCc1c(N)cccc1O |
| InChI | InChI=1S/C16H27NO/c1-2-3-4-5-6-7-8-9-11-14-15(17)12-10-13-16(14)18/h10,12-13,18H,2-9,11,17H2,1H3 |
| InChIKey | GWQOVKIIKZQZES-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-decylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-decylphenol?
The IUPAC name of 3-amino-2-decylphenol (CID 70595254) is 3-amino-2-decylphenol.
What is the SMILES notation for 3-amino-2-decylphenol?
The canonical SMILES for 3-amino-2-decylphenol is CCCCCCCCCCc1c(N)cccc1O.
What is the InChIKey of 3-amino-2-decylphenol?
The InChIKey is GWQOVKIIKZQZES-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO/c1-2-3-4-5-6-7-8-9-11-14-15(17)12-10-13-16(14)18/h10,12-13,18H,2-9,11,17H2,1H3.
What are the key properties of 3-amino-2-decylphenol?
3-amino-2-decylphenol has a molecular weight of 249.40 g/mol, XLogP of 4.66, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-decylphenol is sourced from PubChem (CID 70595254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).