C18H32N2 — CID 18324632
2,3-dihexylbenzene-1,4-diamine (PubChem CID 18324632) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 2,3-dihexylbenzene-1,4-diamine.
| Compound Name | 2,3-dihexylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 18324632 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 2,3-dihexylbenzene-1,4-diamine |
| SMILES | CCCCCCc1c(N)ccc(N)c1CCCCCC |
| InChI | InChI=1S/C18H32N2/c1-3-5-7-9-11-15-16(12-10-8-6-4-2)18(20)14-13-17(15)19/h13-14H,3-12,19-20H2,1-2H3 |
| InChIKey | XLXUBWHQVIDNAK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|