About 3-chloro-2-octylphenol;2-chlorophenol
3-chloro-2-octylphenol;2-chlorophenol (PubChem CID 90156900) has the molecular formula C20H26Cl2O2
and a molecular weight of 369.33 g/mol. Its IUPAC name is 3-chloro-2-octylphenol;2-chlorophenol.
Molecular Properties
| Compound Name | 3-chloro-2-octylphenol;2-chlorophenol |
| PubChem CID | 90156900 |
| Molecular Formula | C20H26Cl2O2 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-chloro-2-octylphenol;2-chlorophenol |
| SMILES | CCCCCCCCc1c(O)cccc1Cl.Oc1ccccc1Cl |
| InChI | InChI=1S/C14H21ClO.C6H5ClO/c1-2-3-4-5-6-7-9-12-13(15)10-8-11-14(12)16;7-5-3-1-2-4-6(5)8/h8,10-11,16H,2-7,9H2,1H3;1-4,8H |
| InChIKey | AOIHHMLMRMTMRR-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-octylphenol;2-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-octylphenol;2-chlorophenol?
The IUPAC name of 3-chloro-2-octylphenol;2-chlorophenol (CID 90156900) is 3-chloro-2-octylphenol;2-chlorophenol.
What is the SMILES notation for 3-chloro-2-octylphenol;2-chlorophenol?
The canonical SMILES for 3-chloro-2-octylphenol;2-chlorophenol is CCCCCCCCc1c(O)cccc1Cl.Oc1ccccc1Cl.
What is the InChIKey of 3-chloro-2-octylphenol;2-chlorophenol?
The InChIKey is AOIHHMLMRMTMRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21ClO.C6H5ClO/c1-2-3-4-5-6-7-9-12-13(15)10-8-11-14(12)16;7-5-3-1-2-4-6(5)8/h8,10-11,16H,2-7,9H2,1H3;1-4,8H.
What are the key properties of 3-chloro-2-octylphenol;2-chlorophenol?
3-chloro-2-octylphenol;2-chlorophenol has a molecular weight of 369.33 g/mol, XLogP of 6.99, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-octylphenol;2-chlorophenol is sourced from PubChem (CID 90156900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).