About 3-methoxy-2-propylphenol
3-methoxy-2-propylphenol (PubChem CID 10607156) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-methoxy-2-propylphenol.
Molecular Properties
| Compound Name | 3-methoxy-2-propylphenol |
| PubChem CID | 10607156 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 3-methoxy-2-propylphenol |
| SMILES | CCCc1c(O)cccc1OC |
| InChI | InChI=1S/C10H14O2/c1-3-5-8-9(11)6-4-7-10(8)12-2/h4,6-7,11H,3,5H2,1-2H3 |
| InChIKey | BLWZYYNYVINOHM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-2-propylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2-propylphenol?
The IUPAC name of 3-methoxy-2-propylphenol (CID 10607156) is 3-methoxy-2-propylphenol.
What is the SMILES notation for 3-methoxy-2-propylphenol?
The canonical SMILES for 3-methoxy-2-propylphenol is CCCc1c(O)cccc1OC.
What is the InChIKey of 3-methoxy-2-propylphenol?
The InChIKey is BLWZYYNYVINOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-3-5-8-9(11)6-4-7-10(8)12-2/h4,6-7,11H,3,5H2,1-2H3.
What are the key properties of 3-methoxy-2-propylphenol?
3-methoxy-2-propylphenol has a molecular weight of 166.22 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-propylphenol is sourced from PubChem (CID 10607156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).