C23H32O4 — CID 57308798
3-[4-(2,3-dimethoxyphenyl)hexoxy]-2-propylphenol (PubChem CID 57308798) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 3-[4-(2,3-dimethoxyphenyl)hexoxy]-2-propylphenol.
| Compound Name | 3-[4-(2,3-dimethoxyphenyl)hexoxy]-2-propylphenol |
|---|---|
| PubChem CID | 57308798 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 3-[4-(2,3-dimethoxyphenyl)hexoxy]-2-propylphenol |
| SMILES | CCCc1c(O)cccc1OCCCC(CC)c1cccc(OC)c1OC |
| InChI | InChI=1S/C23H32O4/c1-5-10-19-20(24)13-8-14-21(19)27-16-9-11-17(6-2)18-12-7-15-22(25-3)23(18)26-4/h7-8,12-15,17,24H,5-6,9-11,16H2,1-4H3 |
| InChIKey | UNHVLPCKQDHSTQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|