About ethane;2-methoxy-6-propylphenol
ethane;2-methoxy-6-propylphenol (PubChem CID 142869062) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is ethane;2-methoxy-6-propylphenol.
Molecular Properties
| Compound Name | ethane;2-methoxy-6-propylphenol |
| PubChem CID | 142869062 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | ethane;2-methoxy-6-propylphenol |
| SMILES | CC.CCCc1cccc(OC)c1O |
| InChI | InChI=1S/C10H14O2.C2H6/c1-3-5-8-6-4-7-9(12-2)10(8)11;1-2/h4,6-7,11H,3,5H2,1-2H3;1-2H3 |
| InChIKey | XOIMLGFCQWSZQF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methoxy-6-propylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxy-6-propylphenol?
The IUPAC name of ethane;2-methoxy-6-propylphenol (CID 142869062) is ethane;2-methoxy-6-propylphenol.
What is the SMILES notation for ethane;2-methoxy-6-propylphenol?
The canonical SMILES for ethane;2-methoxy-6-propylphenol is CC.CCCc1cccc(OC)c1O.
What is the InChIKey of ethane;2-methoxy-6-propylphenol?
The InChIKey is XOIMLGFCQWSZQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2.C2H6/c1-3-5-8-6-4-7-9(12-2)10(8)11;1-2/h4,6-7,11H,3,5H2,1-2H3;1-2H3.
What are the key properties of ethane;2-methoxy-6-propylphenol?
ethane;2-methoxy-6-propylphenol has a molecular weight of 196.29 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxy-6-propylphenol is sourced from PubChem (CID 142869062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).