C11H15NO4 — CID 15659643
methyl N-[2-(2-hydroxy-3-methoxyphenyl)ethyl]carbamate (PubChem CID 15659643) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is methyl N-[2-(2-hydroxy-3-methoxyphenyl)ethyl]carbamate.
| Compound Name | methyl N-[2-(2-hydroxy-3-methoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 15659643 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | methyl N-[2-(2-hydroxy-3-methoxyphenyl)ethyl]carbamate |
| SMILES | COC(=O)NCCc1cccc(OC)c1O |
| InChI | InChI=1S/C11H15NO4/c1-15-9-5-3-4-8(10(9)13)6-7-12-11(14)16-2/h3-5,13H,6-7H2,1-2H3,(H,12,14) |
| InChIKey | HQOHPAPPIORXIC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |