C13H16NO5- — CID 9151605
4-[2-(2-hydroxy-3-methoxyphenyl)ethylamino]-4-oxobutanoate (PubChem CID 9151605) has the molecular formula C13H16NO5- and a molecular weight of 266.27 g/mol. Its IUPAC name is 4-[2-(2-hydroxy-3-methoxyphenyl)ethylamino]-4-oxobutanoate.
| Compound Name | 4-[2-(2-hydroxy-3-methoxyphenyl)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 9151605 |
| Molecular Formula | C13H16NO5- |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 4-[2-(2-hydroxy-3-methoxyphenyl)ethylamino]-4-oxobutanoate |
| SMILES | COc1cccc(CCNC(=O)CCC(=O)[O-])c1O |
| InChI | InChI=1S/C13H17NO5/c1-19-10-4-2-3-9(13(10)18)7-8-14-11(15)5-6-12(16)17/h2-4,18H,5-8H2,1H3,(H,14,15)(H,16,17)/p-1 |
| InChIKey | PLVKNTOTACYYFM-UHFFFAOYSA-M |
| XLogP | -0.41 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |