About 2-butyl-6-methoxyphenol;4-methoxyphenol
2-butyl-6-methoxyphenol;4-methoxyphenol (PubChem CID 174399923) has the molecular formula C18H24O4
and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-butyl-6-methoxyphenol;4-methoxyphenol.
Molecular Properties
| Compound Name | 2-butyl-6-methoxyphenol;4-methoxyphenol |
| PubChem CID | 174399923 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-butyl-6-methoxyphenol;4-methoxyphenol |
| SMILES | CCCCc1cccc(OC)c1O.COc1ccc(O)cc1 |
| InChI | InChI=1S/C11H16O2.C7H8O2/c1-3-4-6-9-7-5-8-10(13-2)11(9)12;1-9-7-4-2-6(8)3-5-7/h5,7-8,12H,3-4,6H2,1-2H3;2-5,8H,1H3 |
| InChIKey | XEBLWSOJWYTGCH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-butyl-6-methoxyphenol;4-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-6-methoxyphenol;4-methoxyphenol?
The IUPAC name of 2-butyl-6-methoxyphenol;4-methoxyphenol (CID 174399923) is 2-butyl-6-methoxyphenol;4-methoxyphenol.
What is the SMILES notation for 2-butyl-6-methoxyphenol;4-methoxyphenol?
The canonical SMILES for 2-butyl-6-methoxyphenol;4-methoxyphenol is CCCCc1cccc(OC)c1O.COc1ccc(O)cc1.
What is the InChIKey of 2-butyl-6-methoxyphenol;4-methoxyphenol?
The InChIKey is XEBLWSOJWYTGCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2.C7H8O2/c1-3-4-6-9-7-5-8-10(13-2)11(9)12;1-9-7-4-2-6(8)3-5-7/h5,7-8,12H,3-4,6H2,1-2H3;2-5,8H,1H3.
What are the key properties of 2-butyl-6-methoxyphenol;4-methoxyphenol?
2-butyl-6-methoxyphenol;4-methoxyphenol has a molecular weight of 304.39 g/mol, XLogP of 4.14, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-6-methoxyphenol;4-methoxyphenol is sourced from PubChem (CID 174399923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).