C12H16O2 — CID 162445839
2-butyl-7-methoxycyclohepta-2,4,6-trien-1-one (PubChem CID 162445839) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-butyl-7-methoxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-butyl-7-methoxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 162445839 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-butyl-7-methoxycyclohepta-2,4,6-trien-1-one |
| SMILES | CCCCc1ccccc(OC)c1=O |
| InChI | InChI=1S/C12H16O2/c1-3-4-7-10-8-5-6-9-11(14-2)12(10)13/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | RKIHAIODVRNLBZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |