About CID 66773753
CID 66773753 (PubChem CID 66773753) has the molecular formula C10H13OSi
and a molecular weight of 177.30 g/mol.
Molecular Properties
| Compound Name | CID 66773753 |
| PubChem CID | 66773753 |
| Molecular Formula | C10H13OSi |
| Molecular Weight | 177.30 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | — |
| SMILES | CCCCc1ccccc1O[Si] |
| InChI | InChI=1S/C10H13OSi/c1-2-3-6-9-7-4-5-8-10(9)11-12/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | AGUFROBULNVLCI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66773753 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66773753?
The IUPAC name of CID 66773753 (CID 66773753) is not available.
What is the SMILES notation for CID 66773753?
The canonical SMILES for CID 66773753 is CCCCc1ccccc1O[Si].
What is the InChIKey of CID 66773753?
The InChIKey is AGUFROBULNVLCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13OSi/c1-2-3-6-9-7-4-5-8-10(9)11-12/h4-5,7-8H,2-3,6H2,1H3.
What are the key properties of CID 66773753?
CID 66773753 has a molecular weight of 177.30 g/mol, XLogP of 2.49, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66773753 is sourced from PubChem (CID 66773753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).