About (2-heptylphenyl) formate
(2-heptylphenyl) formate (PubChem CID 141284661) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is (2-heptylphenyl) formate.
Molecular Properties
| Compound Name | (2-heptylphenyl) formate |
| PubChem CID | 141284661 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (2-heptylphenyl) formate |
| SMILES | CCCCCCCc1ccccc1OC=O |
| InChI | InChI=1S/C14H20O2/c1-2-3-4-5-6-9-13-10-7-8-11-14(13)16-12-15/h7-8,10-12H,2-6,9H2,1H3 |
| InChIKey | UCJJCXQXTVSMOF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-heptylphenyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-heptylphenyl) formate?
The IUPAC name of (2-heptylphenyl) formate (CID 141284661) is (2-heptylphenyl) formate.
What is the SMILES notation for (2-heptylphenyl) formate?
The canonical SMILES for (2-heptylphenyl) formate is CCCCCCCc1ccccc1OC=O.
What is the InChIKey of (2-heptylphenyl) formate?
The InChIKey is UCJJCXQXTVSMOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-2-3-4-5-6-9-13-10-7-8-11-14(13)16-12-15/h7-8,10-12H,2-6,9H2,1H3.
What are the key properties of (2-heptylphenyl) formate?
(2-heptylphenyl) formate has a molecular weight of 220.31 g/mol, XLogP of 3.73, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-heptylphenyl) formate is sourced from PubChem (CID 141284661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).