About CID 159940559
CID 159940559 (PubChem CID 159940559) has the molecular formula C14H22Na
and a molecular weight of 213.32 g/mol.
Molecular Properties
| Compound Name | CID 159940559 |
| PubChem CID | 159940559 |
| Molecular Formula | C14H22Na |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | — |
| SMILES | CCCCc1ccccc1CCCC.[Na] |
| InChI | InChI=1S/C14H22.Na/c1-3-5-9-13-11-7-8-12-14(13)10-6-4-2;/h7-8,11-12H,3-6,9-10H2,1-2H3; |
| InChIKey | OAUZVIXINKUYRB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 159940559 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159940559?
The IUPAC name of CID 159940559 (CID 159940559) is not available.
What is the SMILES notation for CID 159940559?
The canonical SMILES for CID 159940559 is CCCCc1ccccc1CCCC.[Na].
What is the InChIKey of CID 159940559?
The InChIKey is OAUZVIXINKUYRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22.Na/c1-3-5-9-13-11-7-8-12-14(13)10-6-4-2;/h7-8,11-12H,3-6,9-10H2,1-2H3;.
What are the key properties of CID 159940559?
CID 159940559 has a molecular weight of 213.32 g/mol, XLogP of 3.99, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159940559 is sourced from PubChem (CID 159940559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).