C19H24ClFO2 — CID 178141535
5-[(2-chloro-6-fluorophenyl)methoxy]-3-methyl-2-propylphenol;ethane (PubChem CID 178141535) has the molecular formula C19H24ClFO2 and a molecular weight of 338.85 g/mol. Its IUPAC name is 5-[(2-chloro-6-fluorophenyl)methoxy]-3-methyl-2-propylphenol;ethane.
| Compound Name | 5-[(2-chloro-6-fluorophenyl)methoxy]-3-methyl-2-propylphenol;ethane |
|---|---|
| PubChem CID | 178141535 |
| Molecular Formula | C19H24ClFO2 |
| Molecular Weight | 338.85 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 5-[(2-chloro-6-fluorophenyl)methoxy]-3-methyl-2-propylphenol;ethane |
| SMILES | CC.CCCc1c(C)cc(OCc2c(F)cccc2Cl)cc1O |
| InChI | InChI=1S/C17H18ClFO2.C2H6/c1-3-5-13-11(2)8-12(9-17(13)20)21-10-14-15(18)6-4-7-16(14)19;1-2/h4,6-9,20H,3,5,10H2,1-2H3;1-2H3 |
| InChIKey | SUUFKNRIWQCNJI-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.85 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |