C10H14O2 — CID 12529753
5-methyl-2-propylbenzene-1,3-diol (PubChem CID 12529753) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 5-methyl-2-propylbenzene-1,3-diol.
| Compound Name | 5-methyl-2-propylbenzene-1,3-diol |
|---|---|
| PubChem CID | 12529753 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 5-methyl-2-propylbenzene-1,3-diol |
| SMILES | CCCc1c(O)cc(C)cc1O |
| InChI | InChI=1S/C10H14O2/c1-3-4-8-9(11)5-7(2)6-10(8)12/h5-6,11-12H,3-4H2,1-2H3 |
| InChIKey | NBBHDNUKUGMVFI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |