C18H30O — CID 139832191
2,3-dibutyl-4,5-diethylphenol (PubChem CID 139832191) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 2,3-dibutyl-4,5-diethylphenol.
| Compound Name | 2,3-dibutyl-4,5-diethylphenol |
|---|---|
| PubChem CID | 139832191 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 2,3-dibutyl-4,5-diethylphenol |
| SMILES | CCCCc1c(O)cc(CC)c(CC)c1CCCC |
| InChI | InChI=1S/C18H30O/c1-5-9-11-16-15(8-4)14(7-3)13-18(19)17(16)12-10-6-2/h13,19H,5-12H2,1-4H3 |
| InChIKey | VBSJISWOYRTNEI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |