C22H36O2 — CID 141154248
5-decyl-2-methyl-3-(3-methylbut-3-enyl)benzene-1,4-diol (PubChem CID 141154248) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is 5-decyl-2-methyl-3-(3-methylbut-3-enyl)benzene-1,4-diol.
| Compound Name | 5-decyl-2-methyl-3-(3-methylbut-3-enyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 141154248 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 5-decyl-2-methyl-3-(3-methylbut-3-enyl)benzene-1,4-diol |
| SMILES | C=C(C)CCc1c(C)c(O)cc(CCCCCCCCCC)c1O |
| InChI | InChI=1S/C22H36O2/c1-5-6-7-8-9-10-11-12-13-19-16-21(23)18(4)20(22(19)24)15-14-17(2)3/h16,23-24H,2,5-15H2,1,3-4H3 |
| InChIKey | UEOLVVNTTCUGMV-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|