C27H48O — CID 139902763
6-tert-butyl-3-methyl-2,4-dioctylphenol (PubChem CID 139902763) has the molecular formula C27H48O and a molecular weight of 388.68 g/mol. Its IUPAC name is 6-tert-butyl-3-methyl-2,4-dioctylphenol.
| Compound Name | 6-tert-butyl-3-methyl-2,4-dioctylphenol |
|---|---|
| PubChem CID | 139902763 |
| Molecular Formula | C27H48O |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 388.37 |
| IUPAC Name | 6-tert-butyl-3-methyl-2,4-dioctylphenol |
| SMILES | CCCCCCCCc1cc(C(C)(C)C)c(O)c(CCCCCCCC)c1C |
| InChI | InChI=1S/C27H48O/c1-7-9-11-13-15-17-19-23-21-25(27(4,5)6)26(28)24(22(23)3)20-18-16-14-12-10-8-2/h21,28H,7-20H2,1-6H3 |
| InChIKey | DOUDMWBBMYBNAT-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|