C21H37O4P — CID 20506876
(3,5-ditert-butyl-2-hexyl-4-hydroxyphenyl)methylphosphonic acid (PubChem CID 20506876) has the molecular formula C21H37O4P and a molecular weight of 384.50 g/mol. Its IUPAC name is (3,5-ditert-butyl-2-hexyl-4-hydroxyphenyl)methylphosphonic acid.
| Compound Name | (3,5-ditert-butyl-2-hexyl-4-hydroxyphenyl)methylphosphonic acid |
|---|---|
| PubChem CID | 20506876 |
| Molecular Formula | C21H37O4P |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (3,5-ditert-butyl-2-hexyl-4-hydroxyphenyl)methylphosphonic acid |
| SMILES | CCCCCCc1c(CP(=O)(O)O)cc(C(C)(C)C)c(O)c1C(C)(C)C |
| InChI | InChI=1S/C21H37O4P/c1-8-9-10-11-12-16-15(14-26(23,24)25)13-17(20(2,3)4)19(22)18(16)21(5,6)7/h13,22H,8-12,14H2,1-7H3,(H2,23,24,25) |
| InChIKey | OKXPFRVBOULKNE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|