C13H21O4P — CID 22101595
(5-tert-butyl-4-hydroxy-2,3-dimethylphenyl)methylphosphonic acid (PubChem CID 22101595) has the molecular formula C13H21O4P and a molecular weight of 272.28 g/mol. Its IUPAC name is (5-tert-butyl-4-hydroxy-2,3-dimethylphenyl)methylphosphonic acid.
| Compound Name | (5-tert-butyl-4-hydroxy-2,3-dimethylphenyl)methylphosphonic acid |
|---|---|
| PubChem CID | 22101595 |
| Molecular Formula | C13H21O4P |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (5-tert-butyl-4-hydroxy-2,3-dimethylphenyl)methylphosphonic acid |
| SMILES | Cc1c(CP(=O)(O)O)cc(C(C)(C)C)c(O)c1C |
| InChI | InChI=1S/C13H21O4P/c1-8-9(2)12(14)11(13(3,4)5)6-10(8)7-18(15,16)17/h6,14H,7H2,1-5H3,(H2,15,16,17) |
| InChIKey | NPFLOZXULIUQGE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|