C17H29KO4P — CID 162331984
CID 162331984 (PubChem CID 162331984) has the molecular formula C17H29KO4P and a molecular weight of 367.49 g/mol.
| Compound Name | CID 162331984 |
|---|---|
| PubChem CID | 162331984 |
| Molecular Formula | C17H29KO4P |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | — |
| SMILES | CCC(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)P(=O)(O)O.[K] |
| InChI | InChI=1S/C17H29O4P.K/c1-8-14(22(19,20)21)11-9-12(16(2,3)4)15(18)13(10-11)17(5,6)7;/h9-10,14,18H,8H2,1-7H3,(H2,19,20,21); |
| InChIKey | RTGGLBJPEGLANN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|