C19H34KO4P — CID 173169408
potassium;2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol;hydride (PubChem CID 173169408) has the molecular formula C19H34KO4P and a molecular weight of 396.55 g/mol. Its IUPAC name is potassium;2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol;hydride.
| Compound Name | potassium;2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol;hydride |
|---|---|
| PubChem CID | 173169408 |
| Molecular Formula | C19H34KO4P |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | potassium;2,6-ditert-butyl-4-(diethoxyphosphorylmethyl)phenol;hydride |
| SMILES | CCOP(=O)(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)OCC.[H-].[K+] |
| InChI | InChI=1S/C19H33O4P.K.H/c1-9-22-24(21,23-10-2)13-14-11-15(18(3,4)5)17(20)16(12-14)19(6,7)8;;/h11-12,20H,9-10,13H2,1-8H3;;/q;+1;-1 |
| InChIKey | JBBXNOYYSRTOAD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|