C17H29O4P — CID 170064546
2-tert-butyl-4-(dipropoxyphosphorylmethyl)phenol (PubChem CID 170064546) has the molecular formula C17H29O4P and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-tert-butyl-4-(dipropoxyphosphorylmethyl)phenol.
| Compound Name | 2-tert-butyl-4-(dipropoxyphosphorylmethyl)phenol |
|---|---|
| PubChem CID | 170064546 |
| Molecular Formula | C17H29O4P |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-tert-butyl-4-(dipropoxyphosphorylmethyl)phenol |
| SMILES | CCCOP(=O)(Cc1ccc(O)c(C(C)(C)C)c1)OCCC |
| InChI | InChI=1S/C17H29O4P/c1-6-10-20-22(19,21-11-7-2)13-14-8-9-16(18)15(12-14)17(3,4)5/h8-9,12,18H,6-7,10-11,13H2,1-5H3 |
| InChIKey | CFVYJCURXYLXNE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|