C45H69O4P — CID 10996113
4-[bis(4-nonylphenoxy)phosphorylmethyl]-2,6-ditert-butylphenol (PubChem CID 10996113) has the molecular formula C45H69O4P and a molecular weight of 705.02 g/mol. Its IUPAC name is 4-[bis(4-nonylphenoxy)phosphorylmethyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[bis(4-nonylphenoxy)phosphorylmethyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 10996113 |
| Molecular Formula | C45H69O4P |
| Molecular Weight | 705.02 g/mol |
| Exact Mass | 704.49 |
| IUPAC Name | 4-[bis(4-nonylphenoxy)phosphorylmethyl]-2,6-ditert-butylphenol |
| SMILES | CCCCCCCCCc1ccc(OP(=O)(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)Oc2ccc(CCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C45H69O4P/c1-9-11-13-15-17-19-21-23-36-25-29-39(30-26-36)48-50(47,35-38-33-41(44(3,4)5)43(46)42(34-38)45(6,7)8)49-40-31-27-37(28-32-40)24-22-20-18-16-14-12-10-2/h25-34,46H,9-24,35H2,1-8H3 |
| InChIKey | RGNLNMSCBWWMPW-UHFFFAOYSA-N |
| XLogP | 14.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.02 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|