C30H48NO4P — CID 54424774
2,6-ditert-butyl-4-[N-(diethoxyphosphorylmethyl)-4-pentylanilino]phenol (PubChem CID 54424774) has the molecular formula C30H48NO4P and a molecular weight of 517.69 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[N-(diethoxyphosphorylmethyl)-4-pentylanilino]phenol.
| Compound Name | 2,6-ditert-butyl-4-[N-(diethoxyphosphorylmethyl)-4-pentylanilino]phenol |
|---|---|
| PubChem CID | 54424774 |
| Molecular Formula | C30H48NO4P |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | 2,6-ditert-butyl-4-[N-(diethoxyphosphorylmethyl)-4-pentylanilino]phenol |
| SMILES | CCCCCc1ccc(N(CP(=O)(OCC)OCC)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C30H48NO4P/c1-10-13-14-15-23-16-18-24(19-17-23)31(22-36(33,34-11-2)35-12-3)25-20-26(29(4,5)6)28(32)27(21-25)30(7,8)9/h16-21,32H,10-15,22H2,1-9H3 |
| InChIKey | WDHTWXXIFUWCEN-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|