C22H38N2O2 — CID 139821998
3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-pentylpropanehydrazide (PubChem CID 139821998) has the molecular formula C22H38N2O2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-pentylpropanehydrazide.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-pentylpropanehydrazide |
|---|---|
| PubChem CID | 139821998 |
| Molecular Formula | C22H38N2O2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-N-pentylpropanehydrazide |
| SMILES | CCCCCN(N)C(=O)CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H38N2O2/c1-8-9-10-13-24(23)19(25)12-11-16-14-17(21(2,3)4)20(26)18(15-16)22(5,6)7/h14-15,26H,8-13,23H2,1-7H3 |
| InChIKey | JEBXBRUEKPVUGV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|