C27H46N4O4 — CID 87705339
10-N-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]decanedihydrazide (PubChem CID 87705339) has the molecular formula C27H46N4O4 and a molecular weight of 490.69 g/mol. Its IUPAC name is 10-N-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]decanedihydrazide.
| Compound Name | 10-N-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]decanedihydrazide |
|---|---|
| PubChem CID | 87705339 |
| Molecular Formula | C27H46N4O4 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.35 |
| IUPAC Name | 10-N-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyl]decanedihydrazide |
| SMILES | CC(C)(C)c1cc(CCC(=O)N(N)C(=O)CCCCCCCCC(=O)NN)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H46N4O4/c1-26(2,3)20-17-19(18-21(25(20)35)27(4,5)6)15-16-24(34)31(29)23(33)14-12-10-8-7-9-11-13-22(32)30-28/h17-18,35H,7-16,28-29H2,1-6H3,(H,30,32) |
| InChIKey | XQLDJFWOXBUHPP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|