C24H41N3O3 — CID 19902400
N-(3,5-ditert-butyl-4-hydroxyphenyl)-10-hydrazinyl-10-oxodecanamide (PubChem CID 19902400) has the molecular formula C24H41N3O3 and a molecular weight of 419.61 g/mol. Its IUPAC name is N-(3,5-ditert-butyl-4-hydroxyphenyl)-10-hydrazinyl-10-oxodecanamide.
| Compound Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)-10-hydrazinyl-10-oxodecanamide |
|---|---|
| PubChem CID | 19902400 |
| Molecular Formula | C24H41N3O3 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | N-(3,5-ditert-butyl-4-hydroxyphenyl)-10-hydrazinyl-10-oxodecanamide |
| SMILES | CC(C)(C)c1cc(NC(=O)CCCCCCCCC(=O)NN)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H41N3O3/c1-23(2,3)18-15-17(16-19(22(18)30)24(4,5)6)26-20(28)13-11-9-7-8-10-12-14-21(29)27-25/h15-16,30H,7-14,25H2,1-6H3,(H,26,28)(H,27,29) |
| InChIKey | LZTJOPCSMGXVRM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|