C20H33NO2 — CID 126701347
N-(3,5-ditert-butyl-2-hydroxyphenyl)hexanamide (PubChem CID 126701347) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is N-(3,5-ditert-butyl-2-hydroxyphenyl)hexanamide.
| Compound Name | N-(3,5-ditert-butyl-2-hydroxyphenyl)hexanamide |
|---|---|
| PubChem CID | 126701347 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | N-(3,5-ditert-butyl-2-hydroxyphenyl)hexanamide |
| SMILES | CCCCCC(=O)Nc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H33NO2/c1-8-9-10-11-17(22)21-16-13-14(19(2,3)4)12-15(18(16)23)20(5,6)7/h12-13,23H,8-11H2,1-7H3,(H,21,22) |
| InChIKey | CVSXVYGIBCPHGX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|