(3,5-ditert-butyl-2-hydroxyphenyl) decanoate

C24H40O3 — CID 174769108

IUPAC(3,5-ditert-butyl-2-hydroxyphenyl) decanoate
SMILESCCCCCCCCCC(=O)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1O
InChIInChI=1S/C24H40O3/c1-8-9-10-11-12-13-14-15-21(25)27-20-17-18(23(2,3)4)16-19(22(20)26)24(5,6)7/h16-17,26H,8-15H2,1-7H3
InChIKeyOQDYMRIFUFSKJW-UHFFFAOYSA-N
MW376.58 g/mol
LogP7.03
Rot. Bonds9

About (3,5-ditert-butyl-2-hydroxyphenyl) decanoate

(3,5-ditert-butyl-2-hydroxyphenyl) decanoate (PubChem CID 174769108) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is (3,5-ditert-butyl-2-hydroxyphenyl) decanoate.

Molecular Properties

Compound Name(3,5-ditert-butyl-2-hydroxyphenyl) decanoate
PubChem CID174769108
Molecular FormulaC24H40O3
Molecular Weight376.58 g/mol
Exact Mass376.30
IUPAC Name(3,5-ditert-butyl-2-hydroxyphenyl) decanoate
SMILESCCCCCCCCCC(=O)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1O
InChIInChI=1S/C24H40O3/c1-8-9-10-11-12-13-14-15-21(25)27-20-17-18(23(2,3)4)16-19(22(20)26)24(5,6)7/h16-17,26H,8-15H2,1-7H3
InChIKeyOQDYMRIFUFSKJW-UHFFFAOYSA-N
XLogP7.03
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500376.58
LogP ≤ 57.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (3,5-ditert-butyl-2-hydroxyphenyl) decanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,5-ditert-butyl-2-hydroxyphenyl) decanoate?
The IUPAC name of (3,5-ditert-butyl-2-hydroxyphenyl) decanoate (CID 174769108) is (3,5-ditert-butyl-2-hydroxyphenyl) decanoate.
What is the SMILES notation for (3,5-ditert-butyl-2-hydroxyphenyl) decanoate?
The canonical SMILES for (3,5-ditert-butyl-2-hydroxyphenyl) decanoate is CCCCCCCCCC(=O)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1O.
What is the InChIKey of (3,5-ditert-butyl-2-hydroxyphenyl) decanoate?
The InChIKey is OQDYMRIFUFSKJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H40O3/c1-8-9-10-11-12-13-14-15-21(25)27-20-17-18(23(2,3)4)16-19(22(20)26)24(5,6)7/h16-17,26H,8-15H2,1-7H3.
What are the key properties of (3,5-ditert-butyl-2-hydroxyphenyl) decanoate?
(3,5-ditert-butyl-2-hydroxyphenyl) decanoate has a molecular weight of 376.58 g/mol, XLogP of 7.03, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-ditert-butyl-2-hydroxyphenyl) decanoate is sourced from PubChem (CID 174769108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).