C96H144O16 — CID 102175118
[3,6,7,10,11,14,15-hepta(nonanoyloxy)tetraphenylen-2-yl] nonanoate (PubChem CID 102175118) has the molecular formula C96H144O16 and a molecular weight of 1554.19 g/mol. Its IUPAC name is [3,6,7,10,11,14,15-hepta(nonanoyloxy)tetraphenylen-2-yl] nonanoate.
| Compound Name | [3,6,7,10,11,14,15-hepta(nonanoyloxy)tetraphenylen-2-yl] nonanoate |
|---|---|
| PubChem CID | 102175118 |
| Molecular Formula | C96H144O16 |
| Molecular Weight | 1554.19 g/mol |
| Exact Mass | 1553.05 |
| IUPAC Name | [3,6,7,10,11,14,15-hepta(nonanoyloxy)tetraphenylen-2-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)Oc1cc2c(cc1OC(=O)CCCCCCCC)-c1cc(OC(=O)CCCCCCCC)c(OC(=O)CCCCCCCC)cc1-c1cc(OC(=O)CCCCCCCC)c(OC(=O)CCCCCCCC)cc1-c1cc(OC(=O)CCCCCCCC)c(OC(=O)CCCCCCCC)cc1-2 |
| InChI | InChI=1S/C96H144O16/c1-9-17-25-33-41-49-57-89(97)105-81-65-73-74(66-82(81)106-90(98)58-50-42-34-26-18-10-2)76-68-84(108-92(100)60-52-44-36-28-20-12-4)86(110-94(102)62-54-46-38-30-22-14-6)70-78(76)80-72-88(112-96(104)64-56-48-40-32-24-16-8)87(111-95(103)63-55-47-39-31-23-15-7)71-79(80)77-69-85(109-93(101)61-53-45-37-29-21-13-5)83(67-75(73)77)107-91(99)59-51-43-35-27-19-11-3/h65-72H,9-64H2,1-8H3/b75-73-,76-74-,79-77-,80-78- |
| InChIKey | AINVWGYSVWJBEU-VWDYXFTDSA-N |
| XLogP | 27.92 |
| TPSA | 210.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 64 |
| Heavy Atoms | 112 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1554.19 |
| LogP ≤ 5 | 27.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|