C90H128O16 — CID 102166673
[4,10,11,17,18,23,24-hepta(octanoyloxy)-5-hexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2,4,6,8,10,12,15,17,19,21,23,25-tridecaenyl] octanoate (PubChem CID 102166673) has the molecular formula C90H128O16 and a molecular weight of 1466.00 g/mol. Its IUPAC name is [4,10,11,17,18,23,24-hepta(octanoyloxy)-5-hexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2,4,6,8,10,12,15,17,19,21,23,25-tridecaenyl] octanoate.
| Compound Name | [4,10,11,17,18,23,24-hepta(octanoyloxy)-5-hexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2,4,6,8,10,12,15,17,19,21,23,25-tridecaenyl] octanoate |
|---|---|
| PubChem CID | 102166673 |
| Molecular Formula | C90H128O16 |
| Molecular Weight | 1466.00 g/mol |
| Exact Mass | 1464.92 |
| IUPAC Name | [4,10,11,17,18,23,24-hepta(octanoyloxy)-5-hexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2,4,6,8,10,12,15,17,19,21,23,25-tridecaenyl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1cc2c3cc(OC(=O)CCCCCCC)c(OC(=O)CCCCCCC)cc3c3c4cc(OC(=O)CCCCCCC)c(OC(=O)CCCCCCC)cc4c4cc(OC(=O)CCCCCCC)c(OC(=O)CCCCCCC)cc4c3c2cc1OC(=O)CCCCCCC |
| InChI | InChI=1S/C90H128O16/c1-9-17-25-33-41-49-81(91)99-73-57-65-66-58-74(100-82(92)50-42-34-26-18-10-2)78(104-86(96)54-46-38-30-22-14-6)62-70(66)90-72-64-80(106-88(98)56-48-40-32-24-16-8)76(102-84(94)52-44-36-28-20-12-4)60-68(72)67-59-75(101-83(93)51-43-35-27-19-11-3)79(105-87(97)55-47-39-31-23-15-7)63-71(67)89(90)69(65)61-77(73)103-85(95)53-45-37-29-21-13-5/h57-64H,9-56H2,1-8H3 |
| InChIKey | RLKLATDOBYIUOJ-UHFFFAOYSA-N |
| XLogP | 25.58 |
| TPSA | 210.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 56 |
| Heavy Atoms | 106 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1466.00 |
| LogP ≤ 5 | 25.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|